C19H22N2O3 — CID 133201727
N-[(Z)-1-(furan-2-yl)-3-oxo-3-(pentan-2-ylamino)prop-1-en-2-yl]benzamide (PubChem CID 133201727) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is N-[(Z)-1-(furan-2-yl)-3-oxo-3-(pentan-2-ylamino)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(furan-2-yl)-3-oxo-3-(pentan-2-ylamino)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 133201727 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N-[(Z)-1-(furan-2-yl)-3-oxo-3-(pentan-2-ylamino)prop-1-en-2-yl]benzamide |
| SMILES | CCCC(C)NC(=O)/C(=C/c1ccco1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O3/c1-3-8-14(2)20-19(23)17(13-16-11-7-12-24-16)21-18(22)15-9-5-4-6-10-15/h4-7,9-14H,3,8H2,1-2H3,(H,20,23)(H,21,22)/b17-13- |
| InChIKey | MWMZMUTWHZLPGG-LGMDPLHJSA-N |
| XLogP | 3.36 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|