C25H35NO2 — CID 133202318
2-(5-methyl-2-propan-2-ylphenoxy)-N-[3-(4-propan-2-ylphenyl)propyl]propanamide (PubChem CID 133202318) has the molecular formula C25H35NO2 and a molecular weight of 381.56 g/mol. Its IUPAC name is 2-(5-methyl-2-propan-2-ylphenoxy)-N-[3-(4-propan-2-ylphenyl)propyl]propanamide.
| Compound Name | 2-(5-methyl-2-propan-2-ylphenoxy)-N-[3-(4-propan-2-ylphenyl)propyl]propanamide |
|---|---|
| PubChem CID | 133202318 |
| Molecular Formula | C25H35NO2 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | 2-(5-methyl-2-propan-2-ylphenoxy)-N-[3-(4-propan-2-ylphenyl)propyl]propanamide |
| SMILES | Cc1ccc(C(C)C)c(OC(C)C(=O)NCCCc2ccc(C(C)C)cc2)c1 |
| InChI | InChI=1S/C25H35NO2/c1-17(2)22-12-10-21(11-13-22)8-7-15-26-25(27)20(6)28-24-16-19(5)9-14-23(24)18(3)4/h9-14,16-18,20H,7-8,15H2,1-6H3,(H,26,27) |
| InChIKey | AJAJUEKOXZWFSV-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|