C21H27NO2 — CID 133202725
2-(4-ethylphenyl)-N-[1-(4-methoxy-3-methylphenyl)propyl]acetamide (PubChem CID 133202725) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-N-[1-(4-methoxy-3-methylphenyl)propyl]acetamide.
| Compound Name | 2-(4-ethylphenyl)-N-[1-(4-methoxy-3-methylphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 133202725 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 2-(4-ethylphenyl)-N-[1-(4-methoxy-3-methylphenyl)propyl]acetamide |
| SMILES | CCc1ccc(CC(=O)NC(CC)c2ccc(OC)c(C)c2)cc1 |
| InChI | InChI=1S/C21H27NO2/c1-5-16-7-9-17(10-8-16)14-21(23)22-19(6-2)18-11-12-20(24-4)15(3)13-18/h7-13,19H,5-6,14H2,1-4H3,(H,22,23) |
| InChIKey | SQIAKKXSTJQEOH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |