About N-[(1-butan-2-yl-2,5-dimethylpyrrol-3-yl)methyl]ethanamine
N-[(1-butan-2-yl-2,5-dimethylpyrrol-3-yl)methyl]ethanamine (PubChem CID 133202807) has the molecular formula C13H24N2
and a molecular weight of 208.35 g/mol. Its IUPAC name is N-[(1-butan-2-yl-2,5-dimethylpyrrol-3-yl)methyl]ethanamine.
Molecular Properties
| Compound Name | N-[(1-butan-2-yl-2,5-dimethylpyrrol-3-yl)methyl]ethanamine |
| PubChem CID | 133202807 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | N-[(1-butan-2-yl-2,5-dimethylpyrrol-3-yl)methyl]ethanamine |
| SMILES | CCNCc1cc(C)n(C(C)CC)c1C |
| InChI | InChI=1S/C13H24N2/c1-6-10(3)15-11(4)8-13(12(15)5)9-14-7-2/h8,10,14H,6-7,9H2,1-5H3 |
| InChIKey | GQSFJCOKBXDWHN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(1-butan-2-yl-2,5-dimethylpyrrol-3-yl)methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1-butan-2-yl-2,5-dimethylpyrrol-3-yl)methyl]ethanamine?
The IUPAC name of N-[(1-butan-2-yl-2,5-dimethylpyrrol-3-yl)methyl]ethanamine (CID 133202807) is N-[(1-butan-2-yl-2,5-dimethylpyrrol-3-yl)methyl]ethanamine.
What is the SMILES notation for N-[(1-butan-2-yl-2,5-dimethylpyrrol-3-yl)methyl]ethanamine?
The canonical SMILES for N-[(1-butan-2-yl-2,5-dimethylpyrrol-3-yl)methyl]ethanamine is CCNCc1cc(C)n(C(C)CC)c1C.
What is the InChIKey of N-[(1-butan-2-yl-2,5-dimethylpyrrol-3-yl)methyl]ethanamine?
The InChIKey is GQSFJCOKBXDWHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2/c1-6-10(3)15-11(4)8-13(12(15)5)9-14-7-2/h8,10,14H,6-7,9H2,1-5H3.
What are the key properties of N-[(1-butan-2-yl-2,5-dimethylpyrrol-3-yl)methyl]ethanamine?
N-[(1-butan-2-yl-2,5-dimethylpyrrol-3-yl)methyl]ethanamine has a molecular weight of 208.35 g/mol, XLogP of 3.19, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1-butan-2-yl-2,5-dimethylpyrrol-3-yl)methyl]ethanamine is sourced from PubChem (CID 133202807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).