About (3R,4S)-1-benzylpyrrolidine-3,4-diol
(3R,4S)-1-benzylpyrrolidine-3,4-diol (PubChem CID 13320307) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is (3R,4S)-1-benzylpyrrolidine-3,4-diol.
Molecular Properties
| Compound Name | (3R,4S)-1-benzylpyrrolidine-3,4-diol |
| PubChem CID | 13320307 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (3R,4S)-1-benzylpyrrolidine-3,4-diol |
| SMILES | O[C@@H]1CN(Cc2ccccc2)C[C@@H]1O |
| InChI | InChI=1S/C11H15NO2/c13-10-7-12(8-11(10)14)6-9-4-2-1-3-5-9/h1-5,10-11,13-14H,6-8H2/t10-,11+ |
| InChIKey | QJRIUWQPJVPYSO-PHIMTYICSA-N |
| XLogP | 0.22 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R,4S)-1-benzylpyrrolidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-1-benzylpyrrolidine-3,4-diol?
The IUPAC name of (3R,4S)-1-benzylpyrrolidine-3,4-diol (CID 13320307) is (3R,4S)-1-benzylpyrrolidine-3,4-diol.
What is the SMILES notation for (3R,4S)-1-benzylpyrrolidine-3,4-diol?
The canonical SMILES for (3R,4S)-1-benzylpyrrolidine-3,4-diol is O[C@@H]1CN(Cc2ccccc2)C[C@@H]1O.
What is the InChIKey of (3R,4S)-1-benzylpyrrolidine-3,4-diol?
The InChIKey is QJRIUWQPJVPYSO-PHIMTYICSA-N. The full InChI is InChI=1S/C11H15NO2/c13-10-7-12(8-11(10)14)6-9-4-2-1-3-5-9/h1-5,10-11,13-14H,6-8H2/t10-,11+.
What are the key properties of (3R,4S)-1-benzylpyrrolidine-3,4-diol?
(3R,4S)-1-benzylpyrrolidine-3,4-diol has a molecular weight of 193.25 g/mol, XLogP of 0.22, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-1-benzylpyrrolidine-3,4-diol is sourced from PubChem (CID 13320307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).