C22H25Cl2N3O2 — CID 133203490
2-(3-chlorophenoxy)-N-[(Z)-(7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]acetamide (PubChem CID 133203490) has the molecular formula C22H25Cl2N3O2 and a molecular weight of 434.37 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N-[(Z)-(7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]acetamide.
| Compound Name | 2-(3-chlorophenoxy)-N-[(Z)-(7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 133203490 |
| Molecular Formula | C22H25Cl2N3O2 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 2-(3-chlorophenoxy)-N-[(Z)-(7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]acetamide |
| SMILES | CC1CC(C)(C)N(C)c2cc(Cl)c(/C=N\NC(=O)COc3cccc(Cl)c3)cc21 |
| InChI | InChI=1S/C22H25Cl2N3O2/c1-14-11-22(2,3)27(4)20-10-19(24)15(8-18(14)20)12-25-26-21(28)13-29-17-7-5-6-16(23)9-17/h5-10,12,14H,11,13H2,1-4H3,(H,26,28)/b25-12- |
| InChIKey | GZBMHMABQRCWMZ-ROTLSHHCSA-N |
| XLogP | 5.24 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|