C21H30N2O3 — CID 133203958
N-[3-cyano-4-(2-methylpropoxy)phenyl]-1-ethoxy-3-methylcyclohexane-1-carboxamide (PubChem CID 133203958) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is N-[3-cyano-4-(2-methylpropoxy)phenyl]-1-ethoxy-3-methylcyclohexane-1-carboxamide.
| Compound Name | N-[3-cyano-4-(2-methylpropoxy)phenyl]-1-ethoxy-3-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 133203958 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | N-[3-cyano-4-(2-methylpropoxy)phenyl]-1-ethoxy-3-methylcyclohexane-1-carboxamide |
| SMILES | CCOC1(C(=O)Nc2ccc(OCC(C)C)c(C#N)c2)CCCC(C)C1 |
| InChI | InChI=1S/C21H30N2O3/c1-5-26-21(10-6-7-16(4)12-21)20(24)23-18-8-9-19(17(11-18)13-22)25-14-15(2)3/h8-9,11,15-16H,5-7,10,12,14H2,1-4H3,(H,23,24) |
| InChIKey | FAJAIBHLIWGGNX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |