About 3-[4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]butyl]-1-thia-3-azaspiro[4.4]nonane-2,4-dione
3-[4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]butyl]-1-thia-3-azaspiro[4.4]nonane-2,4-dione (PubChem CID 13320444) has the molecular formula C22H28N4O3S
and a molecular weight of 428.56 g/mol. Its IUPAC name is 3-[4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]butyl]-1-thia-3-azaspiro[4.4]nonane-2,4-dione.
Molecular Properties
| Compound Name | 3-[4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]butyl]-1-thia-3-azaspiro[4.4]nonane-2,4-dione |
| PubChem CID | 13320444 |
| Molecular Formula | C22H28N4O3S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 3-[4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]butyl]-1-thia-3-azaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1SC2(CCCC2)C(=O)N1CCCCN1CCN(c2noc3ccccc23)CC1 |
| InChI | InChI=1S/C22H28N4O3S/c27-20-22(9-3-4-10-22)30-21(28)26(20)12-6-5-11-24-13-15-25(16-14-24)19-17-7-1-2-8-18(17)29-23-19/h1-2,7-8H,3-6,9-16H2 |
| InChIKey | ACFQQGWJDCVCLT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]butyl]-1-thia-3-azaspiro[4.4]nonane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]butyl]-1-thia-3-azaspiro[4.4]nonane-2,4-dione?
The IUPAC name of 3-[4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]butyl]-1-thia-3-azaspiro[4.4]nonane-2,4-dione (CID 13320444) is 3-[4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]butyl]-1-thia-3-azaspiro[4.4]nonane-2,4-dione.
What is the SMILES notation for 3-[4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]butyl]-1-thia-3-azaspiro[4.4]nonane-2,4-dione?
The canonical SMILES for 3-[4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]butyl]-1-thia-3-azaspiro[4.4]nonane-2,4-dione is O=C1SC2(CCCC2)C(=O)N1CCCCN1CCN(c2noc3ccccc23)CC1.
What is the InChIKey of 3-[4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]butyl]-1-thia-3-azaspiro[4.4]nonane-2,4-dione?
The InChIKey is ACFQQGWJDCVCLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N4O3S/c27-20-22(9-3-4-10-22)30-21(28)26(20)12-6-5-11-24-13-15-25(16-14-24)19-17-7-1-2-8-18(17)29-23-19/h1-2,7-8H,3-6,9-16H2.
What are the key properties of 3-[4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]butyl]-1-thia-3-azaspiro[4.4]nonane-2,4-dione?
3-[4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]butyl]-1-thia-3-azaspiro[4.4]nonane-2,4-dione has a molecular weight of 428.56 g/mol, XLogP of 3.74, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]butyl]-1-thia-3-azaspiro[4.4]nonane-2,4-dione is sourced from PubChem (CID 13320444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).