C28H31FIN3O4S — CID 133205255
2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(2-fluorophenyl)methyl]amino]-N-(2-methylpropyl)propanamide (PubChem CID 133205255) has the molecular formula C28H31FIN3O4S and a molecular weight of 651.54 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(2-fluorophenyl)methyl]amino]-N-(2-methylpropyl)propanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(2-fluorophenyl)methyl]amino]-N-(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 133205255 |
| Molecular Formula | C28H31FIN3O4S |
| Molecular Weight | 651.54 g/mol |
| Exact Mass | 651.11 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(2-fluorophenyl)methyl]amino]-N-(2-methylpropyl)propanamide |
| SMILES | CC(C)CNC(=O)C(C)N(Cc1ccccc1F)C(=O)CN(c1ccc(I)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H31FIN3O4S/c1-20(2)17-31-28(35)21(3)32(18-22-9-7-8-12-26(22)29)27(34)19-33(24-15-13-23(30)14-16-24)38(36,37)25-10-5-4-6-11-25/h4-16,20-21H,17-19H2,1-3H3,(H,31,35) |
| InChIKey | ACZWAOFMFIRUFK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|