C19H28N2O3 — CID 133205393
N-(3-cyano-4-methoxyphenyl)-2-methyl-2-propoxyheptanamide (PubChem CID 133205393) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is N-(3-cyano-4-methoxyphenyl)-2-methyl-2-propoxyheptanamide.
| Compound Name | N-(3-cyano-4-methoxyphenyl)-2-methyl-2-propoxyheptanamide |
|---|---|
| PubChem CID | 133205393 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | N-(3-cyano-4-methoxyphenyl)-2-methyl-2-propoxyheptanamide |
| SMILES | CCCCCC(C)(OCCC)C(=O)Nc1ccc(OC)c(C#N)c1 |
| InChI | InChI=1S/C19H28N2O3/c1-5-7-8-11-19(3,24-12-6-2)18(22)21-16-9-10-17(23-4)15(13-16)14-20/h9-10,13H,5-8,11-12H2,1-4H3,(H,21,22) |
| InChIKey | OBBJDHHKUUADPB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|