C25H35NO3 — CID 133205462
N-(4-butoxynaphthalen-1-yl)-3-methyl-1-propoxycyclohexane-1-carboxamide (PubChem CID 133205462) has the molecular formula C25H35NO3 and a molecular weight of 397.56 g/mol. Its IUPAC name is N-(4-butoxynaphthalen-1-yl)-3-methyl-1-propoxycyclohexane-1-carboxamide.
| Compound Name | N-(4-butoxynaphthalen-1-yl)-3-methyl-1-propoxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 133205462 |
| Molecular Formula | C25H35NO3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | N-(4-butoxynaphthalen-1-yl)-3-methyl-1-propoxycyclohexane-1-carboxamide |
| SMILES | CCCCOc1ccc(NC(=O)C2(OCCC)CCCC(C)C2)c2ccccc12 |
| InChI | InChI=1S/C25H35NO3/c1-4-6-17-28-23-14-13-22(20-11-7-8-12-21(20)23)26-24(27)25(29-16-5-2)15-9-10-19(3)18-25/h7-8,11-14,19H,4-6,9-10,15-18H2,1-3H3,(H,26,27) |
| InChIKey | RSIIYVWIZUCOKQ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|