About 3-chloro-5-phenoxy-1,2,6-thiadiazin-4-one
3-chloro-5-phenoxy-1,2,6-thiadiazin-4-one (PubChem CID 13320590) has the molecular formula C9H5ClN2O2S
and a molecular weight of 240.67 g/mol. Its IUPAC name is 3-chloro-5-phenoxy-1,2,6-thiadiazin-4-one.
Molecular Properties
| Compound Name | 3-chloro-5-phenoxy-1,2,6-thiadiazin-4-one |
| PubChem CID | 13320590 |
| Molecular Formula | C9H5ClN2O2S |
| Molecular Weight | 240.67 g/mol |
| Exact Mass | 239.98 |
| IUPAC Name | 3-chloro-5-phenoxy-1,2,6-thiadiazin-4-one |
| SMILES | O=c1c(Cl)nsnc1Oc1ccccc1 |
| InChI | InChI=1S/C9H5ClN2O2S/c10-8-7(13)9(12-15-11-8)14-6-4-2-1-3-5-6/h1-5H |
| InChIKey | PKPISMMHAZJUNS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.67 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-chloro-5-phenoxy-1,2,6-thiadiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-phenoxy-1,2,6-thiadiazin-4-one?
The IUPAC name of 3-chloro-5-phenoxy-1,2,6-thiadiazin-4-one (CID 13320590) is 3-chloro-5-phenoxy-1,2,6-thiadiazin-4-one.
What is the SMILES notation for 3-chloro-5-phenoxy-1,2,6-thiadiazin-4-one?
The canonical SMILES for 3-chloro-5-phenoxy-1,2,6-thiadiazin-4-one is O=c1c(Cl)nsnc1Oc1ccccc1.
What is the InChIKey of 3-chloro-5-phenoxy-1,2,6-thiadiazin-4-one?
The InChIKey is PKPISMMHAZJUNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5ClN2O2S/c10-8-7(13)9(12-15-11-8)14-6-4-2-1-3-5-6/h1-5H.
What are the key properties of 3-chloro-5-phenoxy-1,2,6-thiadiazin-4-one?
3-chloro-5-phenoxy-1,2,6-thiadiazin-4-one has a molecular weight of 240.67 g/mol, XLogP of 2.34, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-phenoxy-1,2,6-thiadiazin-4-one is sourced from PubChem (CID 13320590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).