C9H7F6NO — CID 13320609
2-(3-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 13320609) has the molecular formula C9H7F6NO and a molecular weight of 259.15 g/mol. Its IUPAC name is 2-(3-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(3-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 13320609 |
| Molecular Formula | C9H7F6NO |
| Molecular Weight | 259.15 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 2-(3-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Nc1cccc(C(O)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C9H7F6NO/c10-8(11,12)7(17,9(13,14)15)5-2-1-3-6(16)4-5/h1-4,17H,16H2 |
| InChIKey | LLDYYDVBNYAQJM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.15 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|