C30H34BrClN2O3 — CID 133206220
2-[(3-bromophenyl)methyl-[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 133206220) has the molecular formula C30H34BrClN2O3 and a molecular weight of 585.97 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl-[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | 2-[(3-bromophenyl)methyl-[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133206220 |
| Molecular Formula | C30H34BrClN2O3 |
| Molecular Weight | 585.97 g/mol |
| Exact Mass | 584.14 |
| IUPAC Name | 2-[(3-bromophenyl)methyl-[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1cccc(Br)c1)C(=O)COc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C30H34BrClN2O3/c1-4-5-14-33-30(36)27(18-23-10-7-6-8-11-23)34(19-24-12-9-13-25(31)17-24)28(35)20-37-26-15-21(2)29(32)22(3)16-26/h6-13,15-17,27H,4-5,14,18-20H2,1-3H3,(H,33,36) |
| InChIKey | JTPSCUOQYWVSFM-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.97 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|