C34H35BrN4O6S — CID 133206372
2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(4-bromophenyl)methyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 133206372) has the molecular formula C34H35BrN4O6S and a molecular weight of 707.65 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(4-bromophenyl)methyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(4-bromophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133206372 |
| Molecular Formula | C34H35BrN4O6S |
| Molecular Weight | 707.65 g/mol |
| Exact Mass | 706.15 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(4-bromophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Br)cc1)C(=O)CN(c1cccc([N+](=O)[O-])c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C34H35BrN4O6S/c1-2-3-21-36-34(41)32(22-26-11-6-4-7-12-26)37(24-27-17-19-28(35)20-18-27)33(40)25-38(29-13-10-14-30(23-29)39(42)43)46(44,45)31-15-8-5-9-16-31/h4-20,23,32H,2-3,21-22,24-25H2,1H3,(H,36,41) |
| InChIKey | FNVMEDRTUDFUFH-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.65 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|