C30H35Cl2FN4O4S — CID 133207269
N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-[N-(dimethylsulfamoyl)-2-fluoroanilino]acetyl]amino]-3-phenylpropanamide (PubChem CID 133207269) has the molecular formula C30H35Cl2FN4O4S and a molecular weight of 637.61 g/mol. Its IUPAC name is N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-[N-(dimethylsulfamoyl)-2-fluoroanilino]acetyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-[N-(dimethylsulfamoyl)-2-fluoroanilino]acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133207269 |
| Molecular Formula | C30H35Cl2FN4O4S |
| Molecular Weight | 637.61 g/mol |
| Exact Mass | 636.17 |
| IUPAC Name | N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-[N-(dimethylsulfamoyl)-2-fluoroanilino]acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CN(c1ccccc1F)S(=O)(=O)N(C)C |
| InChI | InChI=1S/C30H35Cl2FN4O4S/c1-4-5-17-34-30(39)28(19-22-11-7-6-8-12-22)36(20-23-15-16-24(31)25(32)18-23)29(38)21-37(42(40,41)35(2)3)27-14-10-9-13-26(27)33/h6-16,18,28H,4-5,17,19-21H2,1-3H3,(H,34,39) |
| InChIKey | HDYXPVYIQKRDBT-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.61 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|