C38H40Cl2N4O12 — CID 13320773
[1-[6-[3-(acetyloxymethyl)-2-phenylimidazo[1,2-a]pyridin-1-ium-1-yl]hexyl]-2-phenylimidazo[1,2-a]pyridin-1-ium-3-yl]methyl acetate diperchlorate (PubChem CID 13320773) has the molecular formula C38H40Cl2N4O12 and a molecular weight of 815.66 g/mol. Its IUPAC name is [1-[6-[3-(acetyloxymethyl)-2-phenylimidazo[1,2-a]pyridin-1-ium-1-yl]hexyl]-2-phenylimidazo[1,2-a]pyridin-1-ium-3-yl]methyl acetate diperchlorate.
| Compound Name | [1-[6-[3-(acetyloxymethyl)-2-phenylimidazo[1,2-a]pyridin-1-ium-1-yl]hexyl]-2-phenylimidazo[1,2-a]pyridin-1-ium-3-yl]methyl acetate diperchlorate |
|---|---|
| PubChem CID | 13320773 |
| Molecular Formula | C38H40Cl2N4O12 |
| Molecular Weight | 815.66 g/mol |
| Exact Mass | 814.20 |
| IUPAC Name | [1-[6-[3-(acetyloxymethyl)-2-phenylimidazo[1,2-a]pyridin-1-ium-1-yl]hexyl]-2-phenylimidazo[1,2-a]pyridin-1-ium-3-yl]methyl acetate diperchlorate |
| SMILES | CC(=O)OCc1c(-c2ccccc2)[n+](CCCCCC[n+]2c(-c3ccccc3)c(COC(C)=O)n3ccccc32)c2ccccn12.[O-][Cl+3]([O-])([O-])[O-].[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C38H40N4O4.2ClHO4/c1-29(43)45-27-33-37(31-17-7-5-8-18-31)41(35-21-11-15-23-39(33)35)25-13-3-4-14-26-42-36-22-12-16-24-40(36)34(28-46-30(2)44)38(42)32-19-9-6-10-20-32;2*2-1(3,4)5/h5-12,15-24H,3-4,13-14,25-28H2,1-2H3;2*(H,2,3,4,5)/q+2;;/p-2 |
| InChIKey | ZSSAZYPCYQYWRN-UHFFFAOYSA-L |
| XLogP | -3.02 |
| TPSA | 253.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.66 |
| LogP ≤ 5 | -3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|