C23H24N4O2S — CID 133209126
3-[5-(5-methylfuran-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(3-methylphenyl)propanamide (PubChem CID 133209126) has the molecular formula C23H24N4O2S and a molecular weight of 420.54 g/mol. Its IUPAC name is 3-[5-(5-methylfuran-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(3-methylphenyl)propanamide.
| Compound Name | 3-[5-(5-methylfuran-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(3-methylphenyl)propanamide |
|---|---|
| PubChem CID | 133209126 |
| Molecular Formula | C23H24N4O2S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 3-[5-(5-methylfuran-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(3-methylphenyl)propanamide |
| SMILES | Cc1cccc(NC(=O)CCN2C(=S)NC(c3ccccn3)C2c2ccc(C)o2)c1 |
| InChI | InChI=1S/C23H24N4O2S/c1-15-6-5-7-17(14-15)25-20(28)11-13-27-22(19-10-9-16(2)29-19)21(26-23(27)30)18-8-3-4-12-24-18/h3-10,12,14,21-22H,11,13H2,1-2H3,(H,25,28)(H,26,30) |
| InChIKey | OSMIDBSZFCLLDP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|