C30H29Cl2N5O2S — CID 133209493
3-[5-[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-methoxyphenyl)propanamide (PubChem CID 133209493) has the molecular formula C30H29Cl2N5O2S and a molecular weight of 594.57 g/mol. Its IUPAC name is 3-[5-[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-methoxyphenyl)propanamide.
| Compound Name | 3-[5-[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 133209493 |
| Molecular Formula | C30H29Cl2N5O2S |
| Molecular Weight | 594.57 g/mol |
| Exact Mass | 593.14 |
| IUPAC Name | 3-[5-[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-methoxyphenyl)propanamide |
| SMILES | COc1ccccc1NC(=O)CCN1C(=S)NC(c2ccccn2)C1c1cc(C)n(-c2ccc(Cl)cc2Cl)c1C |
| InChI | InChI=1S/C30H29Cl2N5O2S/c1-18-16-21(19(2)37(18)25-12-11-20(31)17-22(25)32)29-28(24-9-6-7-14-33-24)35-30(40)36(29)15-13-27(38)34-23-8-4-5-10-26(23)39-3/h4-12,14,16-17,28-29H,13,15H2,1-3H3,(H,34,38)(H,35,40) |
| InChIKey | MHWVOCRQWWLYCJ-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.57 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|