C16H20ClN3O2 — CID 133209724
3-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-pentan-2-ylpropanamide (PubChem CID 133209724) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is 3-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-pentan-2-ylpropanamide.
| Compound Name | 3-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-pentan-2-ylpropanamide |
|---|---|
| PubChem CID | 133209724 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 3-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-pentan-2-ylpropanamide |
| SMILES | CCCC(C)NC(=O)CCc1nc(-c2ccccc2Cl)no1 |
| InChI | InChI=1S/C16H20ClN3O2/c1-3-6-11(2)18-14(21)9-10-15-19-16(20-22-15)12-7-4-5-8-13(12)17/h4-5,7-8,11H,3,6,9-10H2,1-2H3,(H,18,21) |
| InChIKey | LNYXSAXJNJNGDA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |