C27H30N2O4S — CID 133210025
N-(2,2-diethyl-3,4-dihydrochromen-4-yl)-4-methyl-3-(phenylsulfamoyl)benzamide (PubChem CID 133210025) has the molecular formula C27H30N2O4S and a molecular weight of 478.61 g/mol. Its IUPAC name is N-(2,2-diethyl-3,4-dihydrochromen-4-yl)-4-methyl-3-(phenylsulfamoyl)benzamide.
| Compound Name | N-(2,2-diethyl-3,4-dihydrochromen-4-yl)-4-methyl-3-(phenylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 133210025 |
| Molecular Formula | C27H30N2O4S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | N-(2,2-diethyl-3,4-dihydrochromen-4-yl)-4-methyl-3-(phenylsulfamoyl)benzamide |
| SMILES | CCC1(CC)CC(NC(=O)c2ccc(C)c(S(=O)(=O)Nc3ccccc3)c2)c2ccccc2O1 |
| InChI | InChI=1S/C27H30N2O4S/c1-4-27(5-2)18-23(22-13-9-10-14-24(22)33-27)28-26(30)20-16-15-19(3)25(17-20)34(31,32)29-21-11-7-6-8-12-21/h6-17,23,29H,4-5,18H2,1-3H3,(H,28,30) |
| InChIKey | QKIRCZHDYHZLGQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |