C23H30N2O5S — CID 133210137
N-[1-(2,5-dimethoxyphenyl)ethyl]-4-methyl-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 133210137) has the molecular formula C23H30N2O5S and a molecular weight of 446.57 g/mol. Its IUPAC name is N-[1-(2,5-dimethoxyphenyl)ethyl]-4-methyl-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[1-(2,5-dimethoxyphenyl)ethyl]-4-methyl-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 133210137 |
| Molecular Formula | C23H30N2O5S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | N-[1-(2,5-dimethoxyphenyl)ethyl]-4-methyl-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | COc1ccc(OC)c(C(C)NC(=O)c2ccc(C)c(S(=O)(=O)N3CCCCC3)c2)c1 |
| InChI | InChI=1S/C23H30N2O5S/c1-16-8-9-18(14-22(16)31(27,28)25-12-6-5-7-13-25)23(26)24-17(2)20-15-19(29-3)10-11-21(20)30-4/h8-11,14-15,17H,5-7,12-13H2,1-4H3,(H,24,26) |
| InChIKey | QTUFHNOHSJVPFJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |