C33H36N2O2 — CID 133212215
2-[benzyl(3-naphthalen-1-ylpropanoyl)amino]-N-(2-methylpropyl)-3-phenylpropanamide (PubChem CID 133212215) has the molecular formula C33H36N2O2 and a molecular weight of 492.66 g/mol. Its IUPAC name is 2-[benzyl(3-naphthalen-1-ylpropanoyl)amino]-N-(2-methylpropyl)-3-phenylpropanamide.
| Compound Name | 2-[benzyl(3-naphthalen-1-ylpropanoyl)amino]-N-(2-methylpropyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 133212215 |
| Molecular Formula | C33H36N2O2 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | 2-[benzyl(3-naphthalen-1-ylpropanoyl)amino]-N-(2-methylpropyl)-3-phenylpropanamide |
| SMILES | CC(C)CNC(=O)C(Cc1ccccc1)N(Cc1ccccc1)C(=O)CCc1cccc2ccccc12 |
| InChI | InChI=1S/C33H36N2O2/c1-25(2)23-34-33(37)31(22-26-12-5-3-6-13-26)35(24-27-14-7-4-8-15-27)32(36)21-20-29-18-11-17-28-16-9-10-19-30(28)29/h3-19,25,31H,20-24H2,1-2H3,(H,34,37) |
| InChIKey | RTTUWXKFEZCISW-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |