About methyl 5-(5-chloro-2,4-diethoxyphenyl)pyrazolidine-3-carboxylate
methyl 5-(5-chloro-2,4-diethoxyphenyl)pyrazolidine-3-carboxylate (PubChem CID 133212938) has the molecular formula C15H21ClN2O4
and a molecular weight of 328.80 g/mol. Its IUPAC name is methyl 5-(5-chloro-2,4-diethoxyphenyl)pyrazolidine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(5-chloro-2,4-diethoxyphenyl)pyrazolidine-3-carboxylate |
| PubChem CID | 133212938 |
| Molecular Formula | C15H21ClN2O4 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | methyl 5-(5-chloro-2,4-diethoxyphenyl)pyrazolidine-3-carboxylate |
| SMILES | CCOc1cc(OCC)c(C2CC(C(=O)OC)NN2)cc1Cl |
| InChI | InChI=1S/C15H21ClN2O4/c1-4-21-13-8-14(22-5-2)10(16)6-9(13)11-7-12(18-17-11)15(19)20-3/h6,8,11-12,17-18H,4-5,7H2,1-3H3 |
| InChIKey | LMKVKGYXUQMCHL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-(5-chloro-2,4-diethoxyphenyl)pyrazolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(5-chloro-2,4-diethoxyphenyl)pyrazolidine-3-carboxylate?
The IUPAC name of methyl 5-(5-chloro-2,4-diethoxyphenyl)pyrazolidine-3-carboxylate (CID 133212938) is methyl 5-(5-chloro-2,4-diethoxyphenyl)pyrazolidine-3-carboxylate.
What is the SMILES notation for methyl 5-(5-chloro-2,4-diethoxyphenyl)pyrazolidine-3-carboxylate?
The canonical SMILES for methyl 5-(5-chloro-2,4-diethoxyphenyl)pyrazolidine-3-carboxylate is CCOc1cc(OCC)c(C2CC(C(=O)OC)NN2)cc1Cl.
What is the InChIKey of methyl 5-(5-chloro-2,4-diethoxyphenyl)pyrazolidine-3-carboxylate?
The InChIKey is LMKVKGYXUQMCHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21ClN2O4/c1-4-21-13-8-14(22-5-2)10(16)6-9(13)11-7-12(18-17-11)15(19)20-3/h6,8,11-12,17-18H,4-5,7H2,1-3H3.
What are the key properties of methyl 5-(5-chloro-2,4-diethoxyphenyl)pyrazolidine-3-carboxylate?
methyl 5-(5-chloro-2,4-diethoxyphenyl)pyrazolidine-3-carboxylate has a molecular weight of 328.80 g/mol, XLogP of 2.22, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(5-chloro-2,4-diethoxyphenyl)pyrazolidine-3-carboxylate is sourced from PubChem (CID 133212938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).