C25H24ClFN2O3 — CID 133213172
N-[(2-chlorophenyl)methyl]-2-[(4-fluorophenyl)methyl-(2-phenoxyacetyl)amino]propanamide (PubChem CID 133213172) has the molecular formula C25H24ClFN2O3 and a molecular weight of 454.93 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-[(4-fluorophenyl)methyl-(2-phenoxyacetyl)amino]propanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-[(4-fluorophenyl)methyl-(2-phenoxyacetyl)amino]propanamide |
|---|---|
| PubChem CID | 133213172 |
| Molecular Formula | C25H24ClFN2O3 |
| Molecular Weight | 454.93 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-[(4-fluorophenyl)methyl-(2-phenoxyacetyl)amino]propanamide |
| SMILES | CC(C(=O)NCc1ccccc1Cl)N(Cc1ccc(F)cc1)C(=O)COc1ccccc1 |
| InChI | InChI=1S/C25H24ClFN2O3/c1-18(25(31)28-15-20-7-5-6-10-23(20)26)29(16-19-11-13-21(27)14-12-19)24(30)17-32-22-8-3-2-4-9-22/h2-14,18H,15-17H2,1H3,(H,28,31) |
| InChIKey | GDTQKPWYWSEYLF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.93 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |