C18H23N3OS — CID 133215604
1-(6-methoxy-3-pyridinyl)-3-(3-methyl-1-phenylbutyl)thiourea (PubChem CID 133215604) has the molecular formula C18H23N3OS and a molecular weight of 329.47 g/mol. Its IUPAC name is 1-(6-methoxy-3-pyridinyl)-3-(3-methyl-1-phenylbutyl)thiourea.
| Compound Name | 1-(6-methoxy-3-pyridinyl)-3-(3-methyl-1-phenylbutyl)thiourea |
|---|---|
| PubChem CID | 133215604 |
| Molecular Formula | C18H23N3OS |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 1-(6-methoxy-3-pyridinyl)-3-(3-methyl-1-phenylbutyl)thiourea |
| SMILES | COc1ccc(NC(=S)NC(CC(C)C)c2ccccc2)cn1 |
| InChI | InChI=1S/C18H23N3OS/c1-13(2)11-16(14-7-5-4-6-8-14)21-18(23)20-15-9-10-17(22-3)19-12-15/h4-10,12-13,16H,11H2,1-3H3,(H2,20,21,23) |
| InChIKey | VLBUZUCCCRRAPB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|