About trans-methoxymethyl (3R,4R)-3-(dimethoxymethyl)-4-(methoxymethoxy)cyclopentane-1-carboxylate
trans-methoxymethyl (3R,4R)-3-(dimethoxymethyl)-4-(methoxymethoxy)cyclopentane-1-carboxylate (PubChem CID 13321597) has the molecular formula C13H24O7
and a molecular weight of 292.33 g/mol. Its IUPAC name is trans-methoxymethyl (3R,4R)-3-(dimethoxymethyl)-4-(methoxymethoxy)cyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | trans-methoxymethyl (3R,4R)-3-(dimethoxymethyl)-4-(methoxymethoxy)cyclopentane-1-carboxylate |
| PubChem CID | 13321597 |
| Molecular Formula | C13H24O7 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | trans-methoxymethyl (3R,4R)-3-(dimethoxymethyl)-4-(methoxymethoxy)cyclopentane-1-carboxylate |
| SMILES | COCOC(=O)C1C[C@@H](OCOC)[C@H](C(OC)OC)C1 |
| InChI | InChI=1S/C13H24O7/c1-15-7-19-11-6-9(12(14)20-8-16-2)5-10(11)13(17-3)18-4/h9-11,13H,5-8H2,1-4H3/t9?,10-,11-/m1/s1 |
| InChIKey | MHXRRZCLTOGRFE-FHZGLPGMSA-N |
| XLogP | 0.77 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze trans-methoxymethyl (3R,4R)-3-(dimethoxymethyl)-4-(methoxymethoxy)cyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-methoxymethyl (3R,4R)-3-(dimethoxymethyl)-4-(methoxymethoxy)cyclopentane-1-carboxylate?
The IUPAC name of trans-methoxymethyl (3R,4R)-3-(dimethoxymethyl)-4-(methoxymethoxy)cyclopentane-1-carboxylate (CID 13321597) is trans-methoxymethyl (3R,4R)-3-(dimethoxymethyl)-4-(methoxymethoxy)cyclopentane-1-carboxylate.
What is the SMILES notation for trans-methoxymethyl (3R,4R)-3-(dimethoxymethyl)-4-(methoxymethoxy)cyclopentane-1-carboxylate?
The canonical SMILES for trans-methoxymethyl (3R,4R)-3-(dimethoxymethyl)-4-(methoxymethoxy)cyclopentane-1-carboxylate is COCOC(=O)C1C[C@@H](OCOC)[C@H](C(OC)OC)C1.
What is the InChIKey of trans-methoxymethyl (3R,4R)-3-(dimethoxymethyl)-4-(methoxymethoxy)cyclopentane-1-carboxylate?
The InChIKey is MHXRRZCLTOGRFE-FHZGLPGMSA-N. The full InChI is InChI=1S/C13H24O7/c1-15-7-19-11-6-9(12(14)20-8-16-2)5-10(11)13(17-3)18-4/h9-11,13H,5-8H2,1-4H3/t9?,10-,11-/m1/s1.
What are the key properties of trans-methoxymethyl (3R,4R)-3-(dimethoxymethyl)-4-(methoxymethoxy)cyclopentane-1-carboxylate?
trans-methoxymethyl (3R,4R)-3-(dimethoxymethyl)-4-(methoxymethoxy)cyclopentane-1-carboxylate has a molecular weight of 292.33 g/mol, XLogP of 0.77, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for trans-methoxymethyl (3R,4R)-3-(dimethoxymethyl)-4-(methoxymethoxy)cyclopentane-1-carboxylate is sourced from PubChem (CID 13321597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).