C8H8O3 — CID 13321638
3a,4,5,6-tetrahydro-2-benzofuran-1,3-dione (PubChem CID 13321638) has the molecular formula C8H8O3 and a molecular weight of 152.15 g/mol. Its IUPAC name is 3a,4,5,6-tetrahydro-2-benzofuran-1,3-dione.
| Compound Name | 3a,4,5,6-tetrahydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 13321638 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | 3a,4,5,6-tetrahydro-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)C2CCCC=C12 |
| InChI | InChI=1S/C8H8O3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h3,6H,1-2,4H2 |
| InChIKey | XVGQCWWUXBWHHZ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|