C16H17ClN2OS — CID 133217062
1-(3-chlorophenyl)-3-(1-phenoxypropan-2-yl)thiourea (PubChem CID 133217062) has the molecular formula C16H17ClN2OS and a molecular weight of 320.85 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(1-phenoxypropan-2-yl)thiourea.
| Compound Name | 1-(3-chlorophenyl)-3-(1-phenoxypropan-2-yl)thiourea |
|---|---|
| PubChem CID | 133217062 |
| Molecular Formula | C16H17ClN2OS |
| Molecular Weight | 320.85 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(1-phenoxypropan-2-yl)thiourea |
| SMILES | CC(COc1ccccc1)NC(=S)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H17ClN2OS/c1-12(11-20-15-8-3-2-4-9-15)18-16(21)19-14-7-5-6-13(17)10-14/h2-10,12H,11H2,1H3,(H2,18,19,21) |
| InChIKey | HPWMPGNBLIMLGQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.85 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|