C31H34N6OS — CID 133218431
3-[5-[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-ethylphenyl)propanamide (PubChem CID 133218431) has the molecular formula C31H34N6OS and a molecular weight of 538.72 g/mol. Its IUPAC name is 3-[5-[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-ethylphenyl)propanamide.
| Compound Name | 3-[5-[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-ethylphenyl)propanamide |
|---|---|
| PubChem CID | 133218431 |
| Molecular Formula | C31H34N6OS |
| Molecular Weight | 538.72 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | 3-[5-[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-ethylphenyl)propanamide |
| SMILES | CCc1ccccc1NC(=O)CCN1C(=S)NC(c2ccccn2)C1c1cccn1-c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C31H34N6OS/c1-4-22-10-5-6-11-25(22)33-28(38)18-21-37-30(29(34-31(37)39)26-12-7-8-19-32-26)27-13-9-20-36(27)24-16-14-23(15-17-24)35(2)3/h5-17,19-20,29-30H,4,18,21H2,1-3H3,(H,33,38)(H,34,39) |
| InChIKey | BMJOYUZGVCQMOF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.72 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|