C19H20N4O3S2 — CID 133219233
2-(N-methylsulfonylanilino)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 133219233) has the molecular formula C19H20N4O3S2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 2-(N-methylsulfonylanilino)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | 2-(N-methylsulfonylanilino)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 133219233 |
| Molecular Formula | C19H20N4O3S2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 2-(N-methylsulfonylanilino)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | CCC(C(=O)Nc1nnc(-c2ccccc2)s1)N(c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C19H20N4O3S2/c1-3-16(23(28(2,25)26)15-12-8-5-9-13-15)17(24)20-19-22-21-18(27-19)14-10-6-4-7-11-14/h4-13,16H,3H2,1-2H3,(H,20,22,24) |
| InChIKey | YCSVOCHBUSRNCU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |