C34H35ClIN3O4S — CID 133219652
2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(3-chlorophenyl)methyl]amino]-N-butan-2-yl-3-phenylpropanamide (PubChem CID 133219652) has the molecular formula C34H35ClIN3O4S and a molecular weight of 744.10 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(3-chlorophenyl)methyl]amino]-N-butan-2-yl-3-phenylpropanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(3-chlorophenyl)methyl]amino]-N-butan-2-yl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133219652 |
| Molecular Formula | C34H35ClIN3O4S |
| Molecular Weight | 744.10 g/mol |
| Exact Mass | 743.11 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(3-chlorophenyl)methyl]amino]-N-butan-2-yl-3-phenylpropanamide |
| SMILES | CCC(C)NC(=O)C(Cc1ccccc1)N(Cc1cccc(Cl)c1)C(=O)CN(c1ccc(I)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C34H35ClIN3O4S/c1-3-25(2)37-34(41)32(22-26-11-6-4-7-12-26)38(23-27-13-10-14-28(35)21-27)33(40)24-39(30-19-17-29(36)18-20-30)44(42,43)31-15-8-5-9-16-31/h4-21,25,32H,3,22-24H2,1-2H3,(H,37,41) |
| InChIKey | IKRUQDQTJLIPIC-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.10 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|