C28H31ClN2O2 — CID 133220811
N-butan-2-yl-2-[(2-chlorophenyl)methyl-(2-phenylacetyl)amino]-3-phenylpropanamide (PubChem CID 133220811) has the molecular formula C28H31ClN2O2 and a molecular weight of 463.02 g/mol. Its IUPAC name is N-butan-2-yl-2-[(2-chlorophenyl)methyl-(2-phenylacetyl)amino]-3-phenylpropanamide.
| Compound Name | N-butan-2-yl-2-[(2-chlorophenyl)methyl-(2-phenylacetyl)amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133220811 |
| Molecular Formula | C28H31ClN2O2 |
| Molecular Weight | 463.02 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | N-butan-2-yl-2-[(2-chlorophenyl)methyl-(2-phenylacetyl)amino]-3-phenylpropanamide |
| SMILES | CCC(C)NC(=O)C(Cc1ccccc1)N(Cc1ccccc1Cl)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C28H31ClN2O2/c1-3-21(2)30-28(33)26(18-22-12-6-4-7-13-22)31(20-24-16-10-11-17-25(24)29)27(32)19-23-14-8-5-9-15-23/h4-17,21,26H,3,18-20H2,1-2H3,(H,30,33) |
| InChIKey | BXOCUGREYKLUQU-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.02 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |