C22H24N4S — CID 133221884
5-[1-(3-methylphenyl)pyrrol-2-yl]-1-propyl-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133221884) has the molecular formula C22H24N4S and a molecular weight of 376.53 g/mol. Its IUPAC name is 5-[1-(3-methylphenyl)pyrrol-2-yl]-1-propyl-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(3-methylphenyl)pyrrol-2-yl]-1-propyl-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133221884 |
| Molecular Formula | C22H24N4S |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 5-[1-(3-methylphenyl)pyrrol-2-yl]-1-propyl-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCCN1C(=S)NC(c2ccccn2)C1c1cccn1-c1cccc(C)c1 |
| InChI | InChI=1S/C22H24N4S/c1-3-13-26-21(20(24-22(26)27)18-10-4-5-12-23-18)19-11-7-14-25(19)17-9-6-8-16(2)15-17/h4-12,14-15,20-21H,3,13H2,1-2H3,(H,24,27) |
| InChIKey | SUOVGZBUBPUHCU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|