C24H34N4OS — CID 133222568
5-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-1-(3-methoxypropyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133222568) has the molecular formula C24H34N4OS and a molecular weight of 426.63 g/mol. Its IUPAC name is 5-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-1-(3-methoxypropyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-1-(3-methoxypropyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133222568 |
| Molecular Formula | C24H34N4OS |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 5-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-1-(3-methoxypropyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COCCCN1C(=S)NC(c2ccccn2)C1c1cc(C)n(C2CCCCC2)c1C |
| InChI | InChI=1S/C24H34N4OS/c1-17-16-20(18(2)28(17)19-10-5-4-6-11-19)23-22(21-12-7-8-13-25-21)26-24(30)27(23)14-9-15-29-3/h7-8,12-13,16,19,22-23H,4-6,9-11,14-15H2,1-3H3,(H,26,30) |
| InChIKey | KUECOBNSNQJEFV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|