C25H19ClN2O3 — CID 1332229
2-chloro-N-[3-[(2-naphthalen-2-yloxyacetyl)amino]phenyl]benzamide (PubChem CID 1332229) has the molecular formula C25H19ClN2O3 and a molecular weight of 430.89 g/mol. Its IUPAC name is 2-chloro-N-[3-[(2-naphthalen-2-yloxyacetyl)amino]phenyl]benzamide.
| Compound Name | 2-chloro-N-[3-[(2-naphthalen-2-yloxyacetyl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 1332229 |
| Molecular Formula | C25H19ClN2O3 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 2-chloro-N-[3-[(2-naphthalen-2-yloxyacetyl)amino]phenyl]benzamide |
| SMILES | O=C(COc1ccc2ccccc2c1)Nc1cccc(NC(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C25H19ClN2O3/c26-23-11-4-3-10-22(23)25(30)28-20-9-5-8-19(15-20)27-24(29)16-31-21-13-12-17-6-1-2-7-18(17)14-21/h1-15H,16H2,(H,27,29)(H,28,30) |
| InChIKey | KCKUWGTUNUEHPO-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |