C27H30N2O6S2 — CID 13322408
1-[2-[[(2R)-2,3-bis(benzoylsulfanyl)propanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 13322408) has the molecular formula C27H30N2O6S2 and a molecular weight of 542.68 g/mol. Its IUPAC name is 1-[2-[[(2R)-2,3-bis(benzoylsulfanyl)propanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[[(2R)-2,3-bis(benzoylsulfanyl)propanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 13322408 |
| Molecular Formula | C27H30N2O6S2 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | 1-[2-[[(2R)-2,3-bis(benzoylsulfanyl)propanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)C(NC(=O)[C@H](CSC(=O)c1ccccc1)SC(=O)c1ccccc1)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C27H30N2O6S2/c1-17(2)22(24(31)29-15-9-14-20(29)25(32)33)28-23(30)21(37-27(35)19-12-7-4-8-13-19)16-36-26(34)18-10-5-3-6-11-18/h3-8,10-13,17,20-22H,9,14-16H2,1-2H3,(H,28,30)(H,32,33)/t20?,21-,22?/m0/s1 |
| InChIKey | ORDVGEAIYCNWPI-ORFBVSJDSA-N |
| XLogP | 3.72 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|