C11H16N2O3S — CID 133224889
N-methyl-2-[methyl(methylsulfonyl)amino]-2-phenylacetamide (PubChem CID 133224889) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is N-methyl-2-[methyl(methylsulfonyl)amino]-2-phenylacetamide.
| Compound Name | N-methyl-2-[methyl(methylsulfonyl)amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 133224889 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | N-methyl-2-[methyl(methylsulfonyl)amino]-2-phenylacetamide |
| SMILES | CNC(=O)C(c1ccccc1)N(C)S(C)(=O)=O |
| InChI | InChI=1S/C11H16N2O3S/c1-12-11(14)10(13(2)17(3,15)16)9-7-5-4-6-8-9/h4-8,10H,1-3H3,(H,12,14) |
| InChIKey | VKUJJJGAVKJQSY-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |