About CID 13322634
CID 13322634 (PubChem CID 13322634) has the molecular formula C3H5O2
and a molecular weight of 73.07 g/mol.
Molecular Properties
| Compound Name | CID 13322634 |
| PubChem CID | 13322634 |
| Molecular Formula | C3H5O2 |
| Molecular Weight | 73.07 g/mol |
| Exact Mass | 73.03 |
| IUPAC Name | — |
| SMILES | [CH2]CC(=O)O |
| InChI | InChI=1S/C3H5O2/c1-2-3(4)5/h1-2H2,(H,4,5) |
| InChIKey | YSQGXIMFEGYKQN-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 73.07 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 13322634 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 13322634?
The IUPAC name of CID 13322634 (CID 13322634) is not available.
What is the SMILES notation for CID 13322634?
The canonical SMILES for CID 13322634 is [CH2]CC(=O)O.
What is the InChIKey of CID 13322634?
The InChIKey is YSQGXIMFEGYKQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5O2/c1-2-3(4)5/h1-2H2,(H,4,5).
What are the key properties of CID 13322634?
CID 13322634 has a molecular weight of 73.07 g/mol, XLogP of 0.30, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 13322634 is sourced from PubChem (CID 13322634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).