C29H34N2O2S — CID 133226746
2-[benzyl-(2-benzylsulfanylacetyl)amino]-N-butan-2-yl-3-phenylpropanamide (PubChem CID 133226746) has the molecular formula C29H34N2O2S and a molecular weight of 474.67 g/mol. Its IUPAC name is 2-[benzyl-(2-benzylsulfanylacetyl)amino]-N-butan-2-yl-3-phenylpropanamide.
| Compound Name | 2-[benzyl-(2-benzylsulfanylacetyl)amino]-N-butan-2-yl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133226746 |
| Molecular Formula | C29H34N2O2S |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 2-[benzyl-(2-benzylsulfanylacetyl)amino]-N-butan-2-yl-3-phenylpropanamide |
| SMILES | CCC(C)NC(=O)C(Cc1ccccc1)N(Cc1ccccc1)C(=O)CSCc1ccccc1 |
| InChI | InChI=1S/C29H34N2O2S/c1-3-23(2)30-29(33)27(19-24-13-7-4-8-14-24)31(20-25-15-9-5-10-16-25)28(32)22-34-21-26-17-11-6-12-18-26/h4-18,23,27H,3,19-22H2,1-2H3,(H,30,33) |
| InChIKey | BBIYKYNLJSMAPH-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |