C33H42N2O2 — CID 133226803
2-[benzyl-[3-(4-tert-butylphenyl)propanoyl]amino]-N-butan-2-yl-3-phenylpropanamide (PubChem CID 133226803) has the molecular formula C33H42N2O2 and a molecular weight of 498.71 g/mol. Its IUPAC name is 2-[benzyl-[3-(4-tert-butylphenyl)propanoyl]amino]-N-butan-2-yl-3-phenylpropanamide.
| Compound Name | 2-[benzyl-[3-(4-tert-butylphenyl)propanoyl]amino]-N-butan-2-yl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133226803 |
| Molecular Formula | C33H42N2O2 |
| Molecular Weight | 498.71 g/mol |
| Exact Mass | 498.32 |
| IUPAC Name | 2-[benzyl-[3-(4-tert-butylphenyl)propanoyl]amino]-N-butan-2-yl-3-phenylpropanamide |
| SMILES | CCC(C)NC(=O)C(Cc1ccccc1)N(Cc1ccccc1)C(=O)CCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C33H42N2O2/c1-6-25(2)34-32(37)30(23-27-13-9-7-10-14-27)35(24-28-15-11-8-12-16-28)31(36)22-19-26-17-20-29(21-18-26)33(3,4)5/h7-18,20-21,25,30H,6,19,22-24H2,1-5H3,(H,34,37) |
| InChIKey | NYXUNASBNOHRKJ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.71 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |