C21H26Cl2N2O3S — CID 133228988
2-(3,4-dichloro-N-methylsulfonylanilino)-N-[1-(4-ethylphenyl)ethyl]butanamide (PubChem CID 133228988) has the molecular formula C21H26Cl2N2O3S and a molecular weight of 457.42 g/mol. Its IUPAC name is 2-(3,4-dichloro-N-methylsulfonylanilino)-N-[1-(4-ethylphenyl)ethyl]butanamide.
| Compound Name | 2-(3,4-dichloro-N-methylsulfonylanilino)-N-[1-(4-ethylphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 133228988 |
| Molecular Formula | C21H26Cl2N2O3S |
| Molecular Weight | 457.42 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 2-(3,4-dichloro-N-methylsulfonylanilino)-N-[1-(4-ethylphenyl)ethyl]butanamide |
| SMILES | CCc1ccc(C(C)NC(=O)C(CC)N(c2ccc(Cl)c(Cl)c2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H26Cl2N2O3S/c1-5-15-7-9-16(10-8-15)14(3)24-21(26)20(6-2)25(29(4,27)28)17-11-12-18(22)19(23)13-17/h7-14,20H,5-6H2,1-4H3,(H,24,26) |
| InChIKey | NJVIERXQSKQSHC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |