About 5-(4-chlorophenoxy)-1-(4-fluorophenoxy)-1-imidazol-1-yl-3,3-dimethylpentan-2-ol
5-(4-chlorophenoxy)-1-(4-fluorophenoxy)-1-imidazol-1-yl-3,3-dimethylpentan-2-ol (PubChem CID 13322910) has the molecular formula C22H24ClFN2O3
and a molecular weight of 418.90 g/mol. Its IUPAC name is 5-(4-chlorophenoxy)-1-(4-fluorophenoxy)-1-imidazol-1-yl-3,3-dimethylpentan-2-ol.
Molecular Properties
| Compound Name | 5-(4-chlorophenoxy)-1-(4-fluorophenoxy)-1-imidazol-1-yl-3,3-dimethylpentan-2-ol |
| PubChem CID | 13322910 |
| Molecular Formula | C22H24ClFN2O3 |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 5-(4-chlorophenoxy)-1-(4-fluorophenoxy)-1-imidazol-1-yl-3,3-dimethylpentan-2-ol |
| SMILES | CC(C)(CCOc1ccc(Cl)cc1)C(O)C(Oc1ccc(F)cc1)n1ccnc1 |
| InChI | InChI=1S/C22H24ClFN2O3/c1-22(2,11-14-28-18-7-3-16(23)4-8-18)20(27)21(26-13-12-25-15-26)29-19-9-5-17(24)6-10-19/h3-10,12-13,15,20-21,27H,11,14H2,1-2H3 |
| InChIKey | VBGRLWRQVDNCHK-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(4-chlorophenoxy)-1-(4-fluorophenoxy)-1-imidazol-1-yl-3,3-dimethylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenoxy)-1-(4-fluorophenoxy)-1-imidazol-1-yl-3,3-dimethylpentan-2-ol?
The IUPAC name of 5-(4-chlorophenoxy)-1-(4-fluorophenoxy)-1-imidazol-1-yl-3,3-dimethylpentan-2-ol (CID 13322910) is 5-(4-chlorophenoxy)-1-(4-fluorophenoxy)-1-imidazol-1-yl-3,3-dimethylpentan-2-ol.
What is the SMILES notation for 5-(4-chlorophenoxy)-1-(4-fluorophenoxy)-1-imidazol-1-yl-3,3-dimethylpentan-2-ol?
The canonical SMILES for 5-(4-chlorophenoxy)-1-(4-fluorophenoxy)-1-imidazol-1-yl-3,3-dimethylpentan-2-ol is CC(C)(CCOc1ccc(Cl)cc1)C(O)C(Oc1ccc(F)cc1)n1ccnc1.
What is the InChIKey of 5-(4-chlorophenoxy)-1-(4-fluorophenoxy)-1-imidazol-1-yl-3,3-dimethylpentan-2-ol?
The InChIKey is VBGRLWRQVDNCHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24ClFN2O3/c1-22(2,11-14-28-18-7-3-16(23)4-8-18)20(27)21(26-13-12-25-15-26)29-19-9-5-17(24)6-10-19/h3-10,12-13,15,20-21,27H,11,14H2,1-2H3.
What are the key properties of 5-(4-chlorophenoxy)-1-(4-fluorophenoxy)-1-imidazol-1-yl-3,3-dimethylpentan-2-ol?
5-(4-chlorophenoxy)-1-(4-fluorophenoxy)-1-imidazol-1-yl-3,3-dimethylpentan-2-ol has a molecular weight of 418.90 g/mol, XLogP of 5.11, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenoxy)-1-(4-fluorophenoxy)-1-imidazol-1-yl-3,3-dimethylpentan-2-ol is sourced from PubChem (CID 13322910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).