About 6-(hydroxymethyl)-2-methoxy-3,6-dihydro-2H-pyran-3-ol
6-(hydroxymethyl)-2-methoxy-3,6-dihydro-2H-pyran-3-ol (PubChem CID 13323017) has the molecular formula C7H12O4
and a molecular weight of 160.17 g/mol. Its IUPAC name is 6-(hydroxymethyl)-2-methoxy-3,6-dihydro-2H-pyran-3-ol.
Molecular Properties
| Compound Name | 6-(hydroxymethyl)-2-methoxy-3,6-dihydro-2H-pyran-3-ol |
| PubChem CID | 13323017 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 6-(hydroxymethyl)-2-methoxy-3,6-dihydro-2H-pyran-3-ol |
| SMILES | COC1OC(CO)C=CC1O |
| InChI | InChI=1S/C7H12O4/c1-10-7-6(9)3-2-5(4-8)11-7/h2-3,5-9H,4H2,1H3 |
| InChIKey | XLCRNRXVGDUCAP-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-(hydroxymethyl)-2-methoxy-3,6-dihydro-2H-pyran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(hydroxymethyl)-2-methoxy-3,6-dihydro-2H-pyran-3-ol?
The IUPAC name of 6-(hydroxymethyl)-2-methoxy-3,6-dihydro-2H-pyran-3-ol (CID 13323017) is 6-(hydroxymethyl)-2-methoxy-3,6-dihydro-2H-pyran-3-ol.
What is the SMILES notation for 6-(hydroxymethyl)-2-methoxy-3,6-dihydro-2H-pyran-3-ol?
The canonical SMILES for 6-(hydroxymethyl)-2-methoxy-3,6-dihydro-2H-pyran-3-ol is COC1OC(CO)C=CC1O.
What is the InChIKey of 6-(hydroxymethyl)-2-methoxy-3,6-dihydro-2H-pyran-3-ol?
The InChIKey is XLCRNRXVGDUCAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4/c1-10-7-6(9)3-2-5(4-8)11-7/h2-3,5-9H,4H2,1H3.
What are the key properties of 6-(hydroxymethyl)-2-methoxy-3,6-dihydro-2H-pyran-3-ol?
6-(hydroxymethyl)-2-methoxy-3,6-dihydro-2H-pyran-3-ol has a molecular weight of 160.17 g/mol, XLogP of -0.73, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(hydroxymethyl)-2-methoxy-3,6-dihydro-2H-pyran-3-ol is sourced from PubChem (CID 13323017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).