2-(4-amino-2,5-dimethylanilino)-3-methylbutanoic acid

C13H20N2O2 — CID 133230852

IUPAC2-(4-amino-2,5-dimethylanilino)-3-methylbutanoic acid
SMILESCc1cc(NC(C(=O)O)C(C)C)c(C)cc1N
InChIInChI=1S/C13H20N2O2/c1-7(2)12(13(16)17)15-11-6-8(3)10(14)5-9(11)4/h5-7,12,15H,14H2,1-4H3,(H,16,17)
InChIKeyQKCFMCGIJYNWIO-UHFFFAOYSA-N
MW236.31 g/mol
LogP2.41
Rot. Bonds4

About 2-(4-amino-2,5-dimethylanilino)-3-methylbutanoic acid

2-(4-amino-2,5-dimethylanilino)-3-methylbutanoic acid (PubChem CID 133230852) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 2-(4-amino-2,5-dimethylanilino)-3-methylbutanoic acid.

Molecular Properties

Compound Name2-(4-amino-2,5-dimethylanilino)-3-methylbutanoic acid
PubChem CID133230852
Molecular FormulaC13H20N2O2
Molecular Weight236.31 g/mol
Exact Mass236.15
IUPAC Name2-(4-amino-2,5-dimethylanilino)-3-methylbutanoic acid
SMILESCc1cc(NC(C(=O)O)C(C)C)c(C)cc1N
InChIInChI=1S/C13H20N2O2/c1-7(2)12(13(16)17)15-11-6-8(3)10(14)5-9(11)4/h5-7,12,15H,14H2,1-4H3,(H,16,17)
InChIKeyQKCFMCGIJYNWIO-UHFFFAOYSA-N
XLogP2.41
TPSA75.35 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.31
LogP ≤ 52.41
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 2-(4-amino-2,5-dimethylanilino)-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-amino-2,5-dimethylanilino)-3-methylbutanoic acid?
The IUPAC name of 2-(4-amino-2,5-dimethylanilino)-3-methylbutanoic acid (CID 133230852) is 2-(4-amino-2,5-dimethylanilino)-3-methylbutanoic acid.
What is the SMILES notation for 2-(4-amino-2,5-dimethylanilino)-3-methylbutanoic acid?
The canonical SMILES for 2-(4-amino-2,5-dimethylanilino)-3-methylbutanoic acid is Cc1cc(NC(C(=O)O)C(C)C)c(C)cc1N.
What is the InChIKey of 2-(4-amino-2,5-dimethylanilino)-3-methylbutanoic acid?
The InChIKey is QKCFMCGIJYNWIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2/c1-7(2)12(13(16)17)15-11-6-8(3)10(14)5-9(11)4/h5-7,12,15H,14H2,1-4H3,(H,16,17).
What are the key properties of 2-(4-amino-2,5-dimethylanilino)-3-methylbutanoic acid?
2-(4-amino-2,5-dimethylanilino)-3-methylbutanoic acid has a molecular weight of 236.31 g/mol, XLogP of 2.41, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-amino-2,5-dimethylanilino)-3-methylbutanoic acid is sourced from PubChem (CID 133230852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).