C18H20ClFN2O4S — CID 133235695
2-(3-chloro-4-fluoro-N-methylsulfonylanilino)-N-[1-(2-methoxyphenyl)ethyl]acetamide (PubChem CID 133235695) has the molecular formula C18H20ClFN2O4S and a molecular weight of 414.89 g/mol. Its IUPAC name is 2-(3-chloro-4-fluoro-N-methylsulfonylanilino)-N-[1-(2-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(3-chloro-4-fluoro-N-methylsulfonylanilino)-N-[1-(2-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 133235695 |
| Molecular Formula | C18H20ClFN2O4S |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 2-(3-chloro-4-fluoro-N-methylsulfonylanilino)-N-[1-(2-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccccc1C(C)NC(=O)CN(c1ccc(F)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C18H20ClFN2O4S/c1-12(14-6-4-5-7-17(14)26-2)21-18(23)11-22(27(3,24)25)13-8-9-16(20)15(19)10-13/h4-10,12H,11H2,1-3H3,(H,21,23) |
| InChIKey | AQOGFAHWWOYVDQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |