C23H25ClN2O4S — CID 133236097
6-chloro-N-(cyclohexen-1-ylmethyl)-4-(4-methylphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 133236097) has the molecular formula C23H25ClN2O4S and a molecular weight of 460.98 g/mol. Its IUPAC name is 6-chloro-N-(cyclohexen-1-ylmethyl)-4-(4-methylphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | 6-chloro-N-(cyclohexen-1-ylmethyl)-4-(4-methylphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 133236097 |
| Molecular Formula | C23H25ClN2O4S |
| Molecular Weight | 460.98 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 6-chloro-N-(cyclohexen-1-ylmethyl)-4-(4-methylphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(C(=O)NCC3=CCCCC3)Oc3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C23H25ClN2O4S/c1-16-7-10-19(11-8-16)31(28,29)26-15-22(30-21-12-9-18(24)13-20(21)26)23(27)25-14-17-5-3-2-4-6-17/h5,7-13,22H,2-4,6,14-15H2,1H3,(H,25,27) |
| InChIKey | IOANTYLLHOIZDM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.98 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|