C32H31F2N3O6S — CID 133237880
2-[(4-fluorophenyl)methyl-[2-[4-[(4-fluorophenyl)sulfamoyl]phenoxy]acetyl]amino]-N-(2-methoxyethyl)-2-phenylacetamide (PubChem CID 133237880) has the molecular formula C32H31F2N3O6S and a molecular weight of 623.68 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl-[2-[4-[(4-fluorophenyl)sulfamoyl]phenoxy]acetyl]amino]-N-(2-methoxyethyl)-2-phenylacetamide.
| Compound Name | 2-[(4-fluorophenyl)methyl-[2-[4-[(4-fluorophenyl)sulfamoyl]phenoxy]acetyl]amino]-N-(2-methoxyethyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 133237880 |
| Molecular Formula | C32H31F2N3O6S |
| Molecular Weight | 623.68 g/mol |
| Exact Mass | 623.19 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl-[2-[4-[(4-fluorophenyl)sulfamoyl]phenoxy]acetyl]amino]-N-(2-methoxyethyl)-2-phenylacetamide |
| SMILES | COCCNC(=O)C(c1ccccc1)N(Cc1ccc(F)cc1)C(=O)COc1ccc(S(=O)(=O)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C32H31F2N3O6S/c1-42-20-19-35-32(39)31(24-5-3-2-4-6-24)37(21-23-7-9-25(33)10-8-23)30(38)22-43-28-15-17-29(18-16-28)44(40,41)36-27-13-11-26(34)12-14-27/h2-18,31,36H,19-22H2,1H3,(H,35,39) |
| InChIKey | GGAIUEFZKWQICT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.68 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|