C26H27FN2O2 — CID 133238256
N-[2-(ethylamino)-2-oxo-1-phenylethyl]-N-[(4-fluorophenyl)methyl]-3-phenylpropanamide (PubChem CID 133238256) has the molecular formula C26H27FN2O2 and a molecular weight of 418.51 g/mol. Its IUPAC name is N-[2-(ethylamino)-2-oxo-1-phenylethyl]-N-[(4-fluorophenyl)methyl]-3-phenylpropanamide.
| Compound Name | N-[2-(ethylamino)-2-oxo-1-phenylethyl]-N-[(4-fluorophenyl)methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133238256 |
| Molecular Formula | C26H27FN2O2 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | N-[2-(ethylamino)-2-oxo-1-phenylethyl]-N-[(4-fluorophenyl)methyl]-3-phenylpropanamide |
| SMILES | CCNC(=O)C(c1ccccc1)N(Cc1ccc(F)cc1)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C26H27FN2O2/c1-2-28-26(31)25(22-11-7-4-8-12-22)29(19-21-13-16-23(27)17-14-21)24(30)18-15-20-9-5-3-6-10-20/h3-14,16-17,25H,2,15,18-19H2,1H3,(H,28,31) |
| InChIKey | VNTMTWWUNOGCPS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |