C31H30N2O4 — CID 133238879
N-benzyl-2-[(4-methoxyphenyl)methyl-(2-phenoxyacetyl)amino]-2-phenylacetamide (PubChem CID 133238879) has the molecular formula C31H30N2O4 and a molecular weight of 494.59 g/mol. Its IUPAC name is N-benzyl-2-[(4-methoxyphenyl)methyl-(2-phenoxyacetyl)amino]-2-phenylacetamide.
| Compound Name | N-benzyl-2-[(4-methoxyphenyl)methyl-(2-phenoxyacetyl)amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 133238879 |
| Molecular Formula | C31H30N2O4 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | N-benzyl-2-[(4-methoxyphenyl)methyl-(2-phenoxyacetyl)amino]-2-phenylacetamide |
| SMILES | COc1ccc(CN(C(=O)COc2ccccc2)C(C(=O)NCc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H30N2O4/c1-36-27-19-17-25(18-20-27)22-33(29(34)23-37-28-15-9-4-10-16-28)30(26-13-7-3-8-14-26)31(35)32-21-24-11-5-2-6-12-24/h2-20,30H,21-23H2,1H3,(H,32,35) |
| InChIKey | SKHYHPPEVNLQMY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |